About 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one
4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one (PubChem CID 106953213) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one |
| PubChem CID | 106953213 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one |
| SMILES | CC1(C)N=C(c2cscn2)NC1=O |
| InChI | InChI=1S/C8H9N3OS/c1-8(2)7(12)10-6(11-8)5-3-13-4-9-5/h3-4H,1-2H3,(H,10,11,12) |
| InChIKey | AILWLCAOCOJYIA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one?
The IUPAC name of 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one (CID 106953213) is 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one.
What is the SMILES notation for 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one?
The canonical SMILES for 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one is CC1(C)N=C(c2cscn2)NC1=O.
What is the InChIKey of 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one?
The InChIKey is AILWLCAOCOJYIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-8(2)7(12)10-6(11-8)5-3-13-4-9-5/h3-4H,1-2H3,(H,10,11,12).
What are the key properties of 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one?
4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one has a molecular weight of 195.25 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-(1,3-thiazol-4-yl)-1H-imidazol-5-one is sourced from PubChem (CID 106953213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).