C26H43NO4Si — CID 10695331
(4S,5S,6R)-N-methoxy-N,4,6-trimethyl-9-phenylmethoxy-5-triethylsilyloxynon-2-ynamide (PubChem CID 10695331) has the molecular formula C26H43NO4Si and a molecular weight of 461.72 g/mol. Its IUPAC name is (4S,5S,6R)-N-methoxy-N,4,6-trimethyl-9-phenylmethoxy-5-triethylsilyloxynon-2-ynamide.
| Compound Name | (4S,5S,6R)-N-methoxy-N,4,6-trimethyl-9-phenylmethoxy-5-triethylsilyloxynon-2-ynamide |
|---|---|
| PubChem CID | 10695331 |
| Molecular Formula | C26H43NO4Si |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | (4S,5S,6R)-N-methoxy-N,4,6-trimethyl-9-phenylmethoxy-5-triethylsilyloxynon-2-ynamide |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@H](C)CCCOCc1ccccc1)[C@@H](C)C#CC(=O)N(C)OC |
| InChI | InChI=1S/C26H43NO4Si/c1-8-32(9-2,10-3)31-26(23(5)18-19-25(28)27(6)29-7)22(4)15-14-20-30-21-24-16-12-11-13-17-24/h11-13,16-17,22-23,26H,8-10,14-15,20-21H2,1-7H3/t22-,23+,26+/m1/s1 |
| InChIKey | HEAHDFJCFLUGFF-UMFSSWHCSA-N |
| XLogP | 5.67 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|