C20H10Cl4F2O2 — CID 10695337
(1S,6R)-1,3,4,6-tetrachloro-7,7-bis(4-fluorophenyl)bicyclo[4.2.0]oct-3-ene-2,5-dione (PubChem CID 10695337) has the molecular formula C20H10Cl4F2O2 and a molecular weight of 462.11 g/mol. Its IUPAC name is (1S,6R)-1,3,4,6-tetrachloro-7,7-bis(4-fluorophenyl)bicyclo[4.2.0]oct-3-ene-2,5-dione.
| Compound Name | (1S,6R)-1,3,4,6-tetrachloro-7,7-bis(4-fluorophenyl)bicyclo[4.2.0]oct-3-ene-2,5-dione |
|---|---|
| PubChem CID | 10695337 |
| Molecular Formula | C20H10Cl4F2O2 |
| Molecular Weight | 462.11 g/mol |
| Exact Mass | 459.94 |
| IUPAC Name | (1S,6R)-1,3,4,6-tetrachloro-7,7-bis(4-fluorophenyl)bicyclo[4.2.0]oct-3-ene-2,5-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)[C@]2(Cl)C(c3ccc(F)cc3)(c3ccc(F)cc3)C[C@]12Cl |
| InChI | InChI=1S/C20H10Cl4F2O2/c21-14-15(22)17(28)20(24)18(9-19(20,23)16(14)27,10-1-5-12(25)6-2-10)11-3-7-13(26)8-4-11/h1-8H,9H2/t19-,20-/m0/s1 |
| InChIKey | IKSINWNQAUNTDF-PMACEKPBSA-N |
| XLogP | 5.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.11 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|