C15H19N3O3 — CID 106953578
5-[(4-hydroxy-2,5-dimethylanilino)methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 106953578) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-[(4-hydroxy-2,5-dimethylanilino)methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[(4-hydroxy-2,5-dimethylanilino)methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106953578 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5-[(4-hydroxy-2,5-dimethylanilino)methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cc(NCc2cn(C)c(=O)n(C)c2=O)c(C)cc1O |
| InChI | InChI=1S/C15H19N3O3/c1-9-6-13(19)10(2)5-12(9)16-7-11-8-17(3)15(21)18(4)14(11)20/h5-6,8,16,19H,7H2,1-4H3 |
| InChIKey | AEEGWDPFGRAQFP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|