C17H21NO3 — CID 106953620
4-[1-(4-hydroxy-3-methoxyphenyl)ethylamino]-2,5-dimethylphenol (PubChem CID 106953620) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[1-(4-hydroxy-3-methoxyphenyl)ethylamino]-2,5-dimethylphenol.
| Compound Name | 4-[1-(4-hydroxy-3-methoxyphenyl)ethylamino]-2,5-dimethylphenol |
|---|---|
| PubChem CID | 106953620 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[1-(4-hydroxy-3-methoxyphenyl)ethylamino]-2,5-dimethylphenol |
| SMILES | COc1cc(C(C)Nc2cc(C)c(O)cc2C)ccc1O |
| InChI | InChI=1S/C17H21NO3/c1-10-8-16(20)11(2)7-14(10)18-12(3)13-5-6-15(19)17(9-13)21-4/h5-9,12,18-20H,1-4H3 |
| InChIKey | ZXBXWFUJOAZOHD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|