About 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one
5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one (PubChem CID 10695381) has the molecular formula C27H34N4OS
and a molecular weight of 462.66 g/mol. Its IUPAC name is 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one |
| PubChem CID | 10695381 |
| Molecular Formula | C27H34N4OS |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one |
| SMILES | CC1(C)SCN(CCCCN2CCN(c3cn(-c4ccccc4)c4ccccc34)CC2)C1=O |
| InChI | InChI=1S/C27H34N4OS/c1-27(2)26(32)30(21-33-27)15-9-8-14-28-16-18-29(19-17-28)25-20-31(22-10-4-3-5-11-22)24-13-7-6-12-23(24)25/h3-7,10-13,20H,8-9,14-19,21H2,1-2H3 |
| InChIKey | SGVMQOUZKGKJHX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one?
The IUPAC name of 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one (CID 10695381) is 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one?
The canonical SMILES for 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one is CC1(C)SCN(CCCCN2CCN(c3cn(-c4ccccc4)c4ccccc34)CC2)C1=O.
What is the InChIKey of 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one?
The InChIKey is SGVMQOUZKGKJHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34N4OS/c1-27(2)26(32)30(21-33-27)15-9-8-14-28-16-18-29(19-17-28)25-20-31(22-10-4-3-5-11-22)24-13-7-6-12-23(24)25/h3-7,10-13,20H,8-9,14-19,21H2,1-2H3.
What are the key properties of 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one?
5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one has a molecular weight of 462.66 g/mol, XLogP of 4.84, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 10695381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).