About CID 10695390
CID 10695390 (PubChem CID 10695390) has the molecular formula C22H22N2O2Sn
and a molecular weight of 465.14 g/mol.
Molecular Properties
| Compound Name | CID 10695390 |
| PubChem CID | 10695390 |
| Molecular Formula | C22H22N2O2Sn |
| Molecular Weight | 465.14 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | — |
| SMILES | CCc1ccc2cccc(O)c2n1.CCc1ccc2cccc(O)c2n1.[Sn] |
| InChI | InChI=1S/2C11H11NO.Sn/c2*1-2-9-7-6-8-4-3-5-10(13)11(8)12-9;/h2*3-7,13H,2H2,1H3; |
| InChIKey | NBCZBQLGBPDRAN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.14 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 10695390 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10695390?
The IUPAC name of CID 10695390 (CID 10695390) is not available.
What is the SMILES notation for CID 10695390?
The canonical SMILES for CID 10695390 is CCc1ccc2cccc(O)c2n1.CCc1ccc2cccc(O)c2n1.[Sn].
What is the InChIKey of CID 10695390?
The InChIKey is NBCZBQLGBPDRAN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H11NO.Sn/c2*1-2-9-7-6-8-4-3-5-10(13)11(8)12-9;/h2*3-7,13H,2H2,1H3;.
What are the key properties of CID 10695390?
CID 10695390 has a molecular weight of 465.14 g/mol, XLogP of 4.62, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10695390 is sourced from PubChem (CID 10695390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).