C28H35NO5 — CID 10695494
[(Z)-C-[4-(2,2-dimethylpropanoyl)phenyl]-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl] 4-(2,2-dimethylpropanoyl)benzoate (PubChem CID 10695494) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is [(Z)-C-[4-(2,2-dimethylpropanoyl)phenyl]-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl] 4-(2,2-dimethylpropanoyl)benzoate.
| Compound Name | [(Z)-C-[4-(2,2-dimethylpropanoyl)phenyl]-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl] 4-(2,2-dimethylpropanoyl)benzoate |
|---|---|
| PubChem CID | 10695494 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | [(Z)-C-[4-(2,2-dimethylpropanoyl)phenyl]-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl] 4-(2,2-dimethylpropanoyl)benzoate |
| SMILES | CC(C)(C)O/N=C(\OC(=O)c1ccc(C(=O)C(C)(C)C)cc1)c1ccc(C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H35NO5/c1-26(2,3)22(30)18-10-14-20(15-11-18)24(29-34-28(7,8)9)33-25(32)21-16-12-19(13-17-21)23(31)27(4,5)6/h10-17H,1-9H3/b29-24- |
| InChIKey | VHLPNIKNUPZZRV-OLFWJLLRSA-N |
| XLogP | 6.48 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|