C12H16N2O4 — CID 106954975
methyl 4-amino-2-(3-amino-2-methyl-3-oxopropoxy)benzoate (PubChem CID 106954975) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 4-amino-2-(3-amino-2-methyl-3-oxopropoxy)benzoate.
| Compound Name | methyl 4-amino-2-(3-amino-2-methyl-3-oxopropoxy)benzoate |
|---|---|
| PubChem CID | 106954975 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | methyl 4-amino-2-(3-amino-2-methyl-3-oxopropoxy)benzoate |
| SMILES | COC(=O)c1ccc(N)cc1OCC(C)C(N)=O |
| InChI | InChI=1S/C12H16N2O4/c1-7(11(14)15)6-18-10-5-8(13)3-4-9(10)12(16)17-2/h3-5,7H,6,13H2,1-2H3,(H2,14,15) |
| InChIKey | IIYGLPPBGNAOLD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|