About 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine
5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine (PubChem CID 106956579) has the molecular formula C9H14ClN3O
and a molecular weight of 215.68 g/mol. Its IUPAC name is 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine |
| PubChem CID | 106956579 |
| Molecular Formula | C9H14ClN3O |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine |
| SMILES | CN(c1nnc(CCl)o1)C1CCCC1 |
| InChI | InChI=1S/C9H14ClN3O/c1-13(7-4-2-3-5-7)9-12-11-8(6-10)14-9/h7H,2-6H2,1H3 |
| InChIKey | NRTRWDDEWIIXIZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine (CID 106956579) is 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine is CN(c1nnc(CCl)o1)C1CCCC1.
What is the InChIKey of 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine?
The InChIKey is NRTRWDDEWIIXIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN3O/c1-13(7-4-2-3-5-7)9-12-11-8(6-10)14-9/h7H,2-6H2,1H3.
What are the key properties of 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine?
5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine has a molecular weight of 215.68 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-N-cyclopentyl-N-methyl-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 106956579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).