C8H13ClN4O2 — CID 106956638
2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N,N-dimethylacetamide (PubChem CID 106956638) has the molecular formula C8H13ClN4O2 and a molecular weight of 232.67 g/mol. Its IUPAC name is 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 106956638 |
| Molecular Formula | C8H13ClN4O2 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(C)c1nnc(CCl)o1 |
| InChI | InChI=1S/C8H13ClN4O2/c1-12(2)7(14)5-13(3)8-11-10-6(4-9)15-8/h4-5H2,1-3H3 |
| InChIKey | UGHJECZKCOPXGV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|