About 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol
2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol (PubChem CID 106956829) has the molecular formula C7H12ClN3O2
and a molecular weight of 205.64 g/mol. Its IUPAC name is 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol |
| PubChem CID | 106956829 |
| Molecular Formula | C7H12ClN3O2 |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol |
| SMILES | CN(CCO)c1nnc(CCCl)o1 |
| InChI | InChI=1S/C7H12ClN3O2/c1-11(4-5-12)7-10-9-6(13-7)2-3-8/h12H,2-5H2,1H3 |
| InChIKey | XSFQNKASFWPTLM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol?
The IUPAC name of 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol (CID 106956829) is 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol.
What is the SMILES notation for 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol?
The canonical SMILES for 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol is CN(CCO)c1nnc(CCCl)o1.
What is the InChIKey of 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol?
The InChIKey is XSFQNKASFWPTLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClN3O2/c1-11(4-5-12)7-10-9-6(13-7)2-3-8/h12H,2-5H2,1H3.
What are the key properties of 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol?
2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol has a molecular weight of 205.64 g/mol, XLogP of 0.28, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]ethanol is sourced from PubChem (CID 106956829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).