About 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol
2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol (PubChem CID 106957047) has the molecular formula C9H16ClN3O2
and a molecular weight of 233.70 g/mol. Its IUPAC name is 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol.
Molecular Properties
| Compound Name | 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol |
| PubChem CID | 106957047 |
| Molecular Formula | C9H16ClN3O2 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol |
| SMILES | CCCN(CCO)c1nnc(C(C)Cl)o1 |
| InChI | InChI=1S/C9H16ClN3O2/c1-3-4-13(5-6-14)9-12-11-8(15-9)7(2)10/h7,14H,3-6H2,1-2H3 |
| InChIKey | UJUQSKOVCUUKFV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol?
The IUPAC name of 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol (CID 106957047) is 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol.
What is the SMILES notation for 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol?
The canonical SMILES for 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol is CCCN(CCO)c1nnc(C(C)Cl)o1.
What is the InChIKey of 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol?
The InChIKey is UJUQSKOVCUUKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN3O2/c1-3-4-13(5-6-14)9-12-11-8(15-9)7(2)10/h7,14H,3-6H2,1-2H3.
What are the key properties of 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol?
2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol has a molecular weight of 233.70 g/mol, XLogP of 1.58, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-propylamino]ethanol is sourced from PubChem (CID 106957047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).