C26H34O4SSi — CID 10695721
[(1R,6R)-3-(benzenesulfonyl)-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10695721) has the molecular formula C26H34O4SSi and a molecular weight of 470.71 g/mol. Its IUPAC name is [(1R,6R)-3-(benzenesulfonyl)-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,6R)-3-(benzenesulfonyl)-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10695721 |
| Molecular Formula | C26H34O4SSi |
| Molecular Weight | 470.71 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | [(1R,6R)-3-(benzenesulfonyl)-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(S(=O)(=O)c2ccccc2)C=C[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C26H34O4SSi/c1-26(2,3)32(4,5)30-25-18-24(31(27,28)23-14-10-7-11-15-23)17-16-22(25)20-29-19-21-12-8-6-9-13-21/h6-18,22,25H,19-20H2,1-5H3/t22-,25+/m1/s1 |
| InChIKey | DOPOLHJKXNISGW-RDGATRHJSA-N |
| XLogP | 6.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|