C11H20ClN3O — CID 106957361
5-(chloromethyl)-N-(2,4,4-trimethylpentan-2-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 106957361) has the molecular formula C11H20ClN3O and a molecular weight of 245.75 g/mol. Its IUPAC name is 5-(chloromethyl)-N-(2,4,4-trimethylpentan-2-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(chloromethyl)-N-(2,4,4-trimethylpentan-2-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106957361 |
| Molecular Formula | C11H20ClN3O |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 5-(chloromethyl)-N-(2,4,4-trimethylpentan-2-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1nnc(CCl)o1 |
| InChI | InChI=1S/C11H20ClN3O/c1-10(2,3)7-11(4,5)13-9-15-14-8(6-12)16-9/h6-7H2,1-5H3,(H,13,15) |
| InChIKey | FISLNGXDDMRMME-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|