C13H14ClN3O — CID 106958051
N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-(1-chloroethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106958051) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-(1-chloroethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-(1-chloroethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106958051 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-(1-chloroethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(Cl)c1nnc(NCC2Cc3ccccc32)o1 |
| InChI | InChI=1S/C13H14ClN3O/c1-8(14)12-16-17-13(18-12)15-7-10-6-9-4-2-3-5-11(9)10/h2-5,8,10H,6-7H2,1H3,(H,15,17) |
| InChIKey | NQDCUVHQFMAUSF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|