C27H27FN4O3 — CID 10695854
1-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea (PubChem CID 10695854) has the molecular formula C27H27FN4O3 and a molecular weight of 474.54 g/mol. Its IUPAC name is 1-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea.
| Compound Name | 1-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 10695854 |
| Molecular Formula | C27H27FN4O3 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea |
| SMILES | CC(C)CCN1C(=O)C(NC(=O)Nc2ccccc2)C(=O)N(c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C27H27FN4O3/c1-18(2)16-17-31-22-14-8-9-15-23(22)32(21-13-7-6-12-20(21)28)26(34)24(25(31)33)30-27(35)29-19-10-4-3-5-11-19/h3-15,18,24H,16-17H2,1-2H3,(H2,29,30,35) |
| InChIKey | CYKZHZIOBOPBJQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|