About 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one
4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one (PubChem CID 106958762) has the molecular formula C9H13ClN4O2
and a molecular weight of 244.68 g/mol. Its IUPAC name is 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one |
| PubChem CID | 106958762 |
| Molecular Formula | C9H13ClN4O2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(c2nnc(CCl)o2)CC1=O |
| InChI | InChI=1S/C9H13ClN4O2/c1-13-3-2-4-14(6-8(13)15)9-12-11-7(5-10)16-9/h2-6H2,1H3 |
| InChIKey | IDHGWIHLPNJDQK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one?
The IUPAC name of 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one (CID 106958762) is 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one.
What is the SMILES notation for 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one?
The canonical SMILES for 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one is CN1CCCN(c2nnc(CCl)o2)CC1=O.
What is the InChIKey of 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one?
The InChIKey is IDHGWIHLPNJDQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN4O2/c1-13-3-2-4-14(6-8(13)15)9-12-11-7(5-10)16-9/h2-6H2,1H3.
What are the key properties of 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one?
4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one has a molecular weight of 244.68 g/mol, XLogP of 0.48, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-1-methyl-1,4-diazepan-2-one is sourced from PubChem (CID 106958762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).