C12H13Cl2N3O3 — CID 106958974
N-(4-chloro-2,5-dimethoxyphenyl)-5-(1-chloroethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106958974) has the molecular formula C12H13Cl2N3O3 and a molecular weight of 318.16 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-5-(1-chloroethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-5-(1-chloroethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106958974 |
| Molecular Formula | C12H13Cl2N3O3 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-5-(1-chloroethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | COc1cc(Nc2nnc(C(C)Cl)o2)c(OC)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N3O3/c1-6(13)11-16-17-12(20-11)15-8-5-9(18-2)7(14)4-10(8)19-3/h4-6H,1-3H3,(H,15,17) |
| InChIKey | SEVXYCMQTZSNNN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|