C10H17ClN4O2 — CID 106959222
3-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N,2-dimethylpropanamide (PubChem CID 106959222) has the molecular formula C10H17ClN4O2 and a molecular weight of 260.73 g/mol. Its IUPAC name is 3-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N,2-dimethylpropanamide.
| Compound Name | 3-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106959222 |
| Molecular Formula | C10H17ClN4O2 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)CN(C)c1nnc(CCCl)o1 |
| InChI | InChI=1S/C10H17ClN4O2/c1-7(9(16)12-2)6-15(3)10-14-13-8(17-10)4-5-11/h7H,4-6H2,1-3H3,(H,12,16) |
| InChIKey | QUVMEJADGZKYRH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|