C11H20N4O2 — CID 106959475
1-[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]piperidin-3-ol (PubChem CID 106959475) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]piperidin-3-ol.
| Compound Name | 1-[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 106959475 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]piperidin-3-ol |
| SMILES | CCCNCc1nnc(N2CCCC(O)C2)o1 |
| InChI | InChI=1S/C11H20N4O2/c1-2-5-12-7-10-13-14-11(17-10)15-6-3-4-9(16)8-15/h9,12,16H,2-8H2,1H3 |
| InChIKey | QBNIHARFZGMESA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|