C28H21F3O4 — CID 10696002
benzyl 2,3,5-trifluoro-4,6-bis(phenylmethoxy)benzoate (PubChem CID 10696002) has the molecular formula C28H21F3O4 and a molecular weight of 478.47 g/mol. Its IUPAC name is benzyl 2,3,5-trifluoro-4,6-bis(phenylmethoxy)benzoate.
| Compound Name | benzyl 2,3,5-trifluoro-4,6-bis(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 10696002 |
| Molecular Formula | C28H21F3O4 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | benzyl 2,3,5-trifluoro-4,6-bis(phenylmethoxy)benzoate |
| SMILES | O=C(OCc1ccccc1)c1c(F)c(F)c(OCc2ccccc2)c(F)c1OCc1ccccc1 |
| InChI | InChI=1S/C28H21F3O4/c29-23-22(28(32)35-18-21-14-8-3-9-15-21)26(33-16-19-10-4-1-5-11-19)25(31)27(24(23)30)34-17-20-12-6-2-7-13-20/h1-15H,16-18H2 |
| InChIKey | RTNMFNVLDQIUMS-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|