About N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine
N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106960616) has the molecular formula C12H18N6O
and a molecular weight of 262.32 g/mol. Its IUPAC name is N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
| PubChem CID | 106960616 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCNCc1nnc(NCc2cnc(C)cn2)o1 |
| InChI | InChI=1S/C12H18N6O/c1-3-4-13-8-11-17-18-12(19-11)16-7-10-6-14-9(2)5-15-10/h5-6,13H,3-4,7-8H2,1-2H3,(H,16,18) |
| InChIKey | DQLDIUBGKUJNMU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine?
The IUPAC name of N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine (CID 106960616) is N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine?
The canonical SMILES for N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine is CCCNCc1nnc(NCc2cnc(C)cn2)o1.
What is the InChIKey of N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine?
The InChIKey is DQLDIUBGKUJNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N6O/c1-3-4-13-8-11-17-18-12(19-11)16-7-10-6-14-9(2)5-15-10/h5-6,13H,3-4,7-8H2,1-2H3,(H,16,18).
What are the key properties of N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine?
N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine has a molecular weight of 262.32 g/mol, XLogP of 1.28, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methylpyrazin-2-yl)methyl]-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 106960616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).