C34H41NO — CID 10696068
2-[(1S)-5-[[(1R,2R,3S,4R)-3-benzhydryl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-methylcyclohexa-2,4-dien-1-yl]-2-methylpropanenitrile (PubChem CID 10696068) has the molecular formula C34H41NO and a molecular weight of 479.71 g/mol. Its IUPAC name is 2-[(1S)-5-[[(1R,2R,3S,4R)-3-benzhydryl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-methylcyclohexa-2,4-dien-1-yl]-2-methylpropanenitrile.
| Compound Name | 2-[(1S)-5-[[(1R,2R,3S,4R)-3-benzhydryl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-methylcyclohexa-2,4-dien-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 10696068 |
| Molecular Formula | C34H41NO |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | 2-[(1S)-5-[[(1R,2R,3S,4R)-3-benzhydryl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-methylcyclohexa-2,4-dien-1-yl]-2-methylpropanenitrile |
| SMILES | CC1=CC=C(O[C@@H]2[C@H](C(c3ccccc3)c3ccccc3)[C@H]3CC[C@]2(C)C3(C)C)C[C@@H]1C(C)(C)C#N |
| InChI | InChI=1S/C34H41NO/c1-23-17-18-26(21-28(23)32(2,3)22-35)36-31-30(27-19-20-34(31,6)33(27,4)5)29(24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-18,27-31H,19-21H2,1-6H3/t27-,28+,30+,31-,34+/m1/s1 |
| InChIKey | RQXSUDJWOFXRAY-BEILRLPOSA-N |
| XLogP | 8.68 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |