C7H14N4OS — CID 106961320
5-(1-aminoethyl)-N-(2-methylsulfanylethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106961320) has the molecular formula C7H14N4OS and a molecular weight of 202.28 g/mol. Its IUPAC name is 5-(1-aminoethyl)-N-(2-methylsulfanylethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1-aminoethyl)-N-(2-methylsulfanylethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106961320 |
| Molecular Formula | C7H14N4OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 5-(1-aminoethyl)-N-(2-methylsulfanylethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CSCCNc1nnc(C(C)N)o1 |
| InChI | InChI=1S/C7H14N4OS/c1-5(8)6-10-11-7(12-6)9-3-4-13-2/h5H,3-4,8H2,1-2H3,(H,9,11) |
| InChIKey | PHKCGOVQJWBXSR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|