C22H46O7Si2 — CID 10696241
methyl (4R,5S)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,3,3-tetradeuterio-3-hydroxypropyl]-4,5-dideuterio-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 10696241) has the molecular formula C22H46O7Si2 and a molecular weight of 484.81 g/mol. Its IUPAC name is methyl (4R,5S)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,3,3-tetradeuterio-3-hydroxypropyl]-4,5-dideuterio-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4R,5S)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,3,3-tetradeuterio-3-hydroxypropyl]-4,5-dideuterio-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 10696241 |
| Molecular Formula | C22H46O7Si2 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | methyl (4R,5S)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,3,3-tetradeuterio-3-hydroxypropyl]-4,5-dideuterio-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | [2H]C([2H])(O)[C@@]([2H])(O[Si](C)(C)C(C)(C)C)[C@@]([2H])(O[Si](C)(C)C(C)(C)C)[C@@]1([2H])OC(C)(C)O[C@@]1([2H])C(=O)OC |
| InChI | InChI=1S/C22H46O7Si2/c1-20(2,3)30(10,11)28-15(14-23)16(29-31(12,13)21(4,5)6)17-18(19(24)25-9)27-22(7,8)26-17/h15-18,23H,14H2,1-13H3/t15-,16-,17-,18-/m1/s1/i14D2,15D,16D,17D,18D |
| InChIKey | MQFPQAKGIHCWLO-DZHJCJFSSA-N |
| XLogP | 4.45 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|