About 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine
5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 106963058) has the molecular formula C8H12N6O
and a molecular weight of 208.23 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine |
| PubChem CID | 106963058 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | CNCc1nnc(Nc2ccn(C)n2)o1 |
| InChI | InChI=1S/C8H12N6O/c1-9-5-7-11-12-8(15-7)10-6-3-4-14(2)13-6/h3-4,9H,5H2,1-2H3,(H,10,12,13) |
| InChIKey | KTVPLKMJOZPMBA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine (CID 106963058) is 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine is CNCc1nnc(Nc2ccn(C)n2)o1.
What is the InChIKey of 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine?
The InChIKey is KTVPLKMJOZPMBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6O/c1-9-5-7-11-12-8(15-7)10-6-3-4-14(2)13-6/h3-4,9H,5H2,1-2H3,(H,10,12,13).
What are the key properties of 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine?
5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine has a molecular weight of 208.23 g/mol, XLogP of 0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylaminomethyl)-N-(1-methylpyrazol-3-yl)-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 106963058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).