C16H32N4O — CID 106963397
5-[(tert-butylamino)methyl]-N-(2,2-dimethylheptyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106963397) has the molecular formula C16H32N4O and a molecular weight of 296.46 g/mol. Its IUPAC name is 5-[(tert-butylamino)methyl]-N-(2,2-dimethylheptyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(tert-butylamino)methyl]-N-(2,2-dimethylheptyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106963397 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 5-[(tert-butylamino)methyl]-N-(2,2-dimethylheptyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCCCC(C)(C)CNc1nnc(CNC(C)(C)C)o1 |
| InChI | InChI=1S/C16H32N4O/c1-7-8-9-10-16(5,6)12-17-14-20-19-13(21-14)11-18-15(2,3)4/h18H,7-12H2,1-6H3,(H,17,20) |
| InChIKey | VWMIDHUDUVBGOB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|