About 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine
5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106963519) has the molecular formula C10H18N4O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine |
| PubChem CID | 106963519 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CC1(CNc2nnc(CCN)o2)CCCO1 |
| InChI | InChI=1S/C10H18N4O2/c1-10(4-2-6-15-10)7-12-9-14-13-8(16-9)3-5-11/h2-7,11H2,1H3,(H,12,14) |
| InChIKey | NPHGDDSEQZRVQX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine (CID 106963519) is 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine is CC1(CNc2nnc(CCN)o2)CCCO1.
What is the InChIKey of 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine?
The InChIKey is NPHGDDSEQZRVQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2/c1-10(4-2-6-15-10)7-12-9-14-13-8(16-9)3-5-11/h2-7,11H2,1H3,(H,12,14).
What are the key properties of 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine?
5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine has a molecular weight of 226.28 g/mol, XLogP of 0.55, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethyl)-N-[(2-methyloxolan-2-yl)methyl]-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 106963519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).