C12H19N5O2 — CID 106963632
6-[5-(methylaminomethyl)-1,3,4-oxadiazol-2-yl]-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one (PubChem CID 106963632) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 6-[5-(methylaminomethyl)-1,3,4-oxadiazol-2-yl]-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one.
| Compound Name | 6-[5-(methylaminomethyl)-1,3,4-oxadiazol-2-yl]-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 106963632 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 6-[5-(methylaminomethyl)-1,3,4-oxadiazol-2-yl]-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
| SMILES | CNCc1nnc(N2CCC3NC(=O)CCC3C2)o1 |
| InChI | InChI=1S/C12H19N5O2/c1-13-6-11-15-16-12(19-11)17-5-4-9-8(7-17)2-3-10(18)14-9/h8-9,13H,2-7H2,1H3,(H,14,18) |
| InChIKey | KAXUGNRIYFGIII-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |