C26H27N5O3S — CID 10696389
2-(5-carbamimidoyl-1H-indol-3-yl)-N-[4-[2-(propylsulfamoyl)phenyl]phenyl]acetamide (PubChem CID 10696389) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-(5-carbamimidoyl-1H-indol-3-yl)-N-[4-[2-(propylsulfamoyl)phenyl]phenyl]acetamide.
| Compound Name | 2-(5-carbamimidoyl-1H-indol-3-yl)-N-[4-[2-(propylsulfamoyl)phenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 10696389 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2-(5-carbamimidoyl-1H-indol-3-yl)-N-[4-[2-(propylsulfamoyl)phenyl]phenyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc2[nH]cc(CC(=O)Nc3ccc(-c4ccccc4S(=O)(=O)NCCC)cc3)c2c1 |
| InChI | InChI=1S/C26H27N5O3S/c1-2-13-30-35(33,34)24-6-4-3-5-21(24)17-7-10-20(11-8-17)31-25(32)15-19-16-29-23-12-9-18(26(27)28)14-22(19)23/h3-12,14,16,29-30H,2,13,15H2,1H3,(H3,27,28)(H,31,32) |
| InChIKey | OHOPQKAWNUVNGK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|