C11H19F3N4O — CID 106963969
5-[(propan-2-ylamino)methyl]-N-(5,5,5-trifluoropentyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106963969) has the molecular formula C11H19F3N4O and a molecular weight of 280.29 g/mol. Its IUPAC name is 5-[(propan-2-ylamino)methyl]-N-(5,5,5-trifluoropentyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(propan-2-ylamino)methyl]-N-(5,5,5-trifluoropentyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106963969 |
| Molecular Formula | C11H19F3N4O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 5-[(propan-2-ylamino)methyl]-N-(5,5,5-trifluoropentyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(C)NCc1nnc(NCCCCC(F)(F)F)o1 |
| InChI | InChI=1S/C11H19F3N4O/c1-8(2)16-7-9-17-18-10(19-9)15-6-4-3-5-11(12,13)14/h8,16H,3-7H2,1-2H3,(H,15,18) |
| InChIKey | HUPPLHVPFYYODC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|