C12H21F3N4O — CID 106963979
5-[(2-methylpropylamino)methyl]-N-(5,5,5-trifluoropentyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106963979) has the molecular formula C12H21F3N4O and a molecular weight of 294.32 g/mol. Its IUPAC name is 5-[(2-methylpropylamino)methyl]-N-(5,5,5-trifluoropentyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(2-methylpropylamino)methyl]-N-(5,5,5-trifluoropentyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106963979 |
| Molecular Formula | C12H21F3N4O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 5-[(2-methylpropylamino)methyl]-N-(5,5,5-trifluoropentyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(C)CNCc1nnc(NCCCCC(F)(F)F)o1 |
| InChI | InChI=1S/C12H21F3N4O/c1-9(2)7-16-8-10-18-19-11(20-10)17-6-4-3-5-12(13,14)15/h9,16H,3-8H2,1-2H3,(H,17,19) |
| InChIKey | GJXNTUPJCWMQTK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|