About CID 10696443
CID 10696443 (PubChem CID 10696443) has the molecular formula C26H33FeNOSSi+2
and a molecular weight of 491.55 g/mol.
Molecular Properties
| Compound Name | CID 10696443 |
| PubChem CID | 10696443 |
| Molecular Formula | C26H33FeNOSSi+2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[C@H]1COC([C]2[C](Sc3ccccc3)[CH][CH][C]2[Si](C)(C)C)=N1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C21H28NOSSi.C5H5.Fe/c1-21(2,3)18-14-23-20(22-18)19-16(12-13-17(19)25(4,5)6)24-15-10-8-7-9-11-15;1-2-4-5-3-1;/h7-13,18H,14H2,1-6H3;1-5H;/q;;+2/t18-;;/m1../s1 |
| InChIKey | JNFAVRIXEGDFIP-JPKZNVRTSA-N |
| XLogP | 6.62 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10696443 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10696443?
The IUPAC name of CID 10696443 (CID 10696443) is not available.
What is the SMILES notation for CID 10696443?
The canonical SMILES for CID 10696443 is CC(C)(C)[C@H]1COC([C]2[C](Sc3ccccc3)[CH][CH][C]2[Si](C)(C)C)=N1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 10696443?
The InChIKey is JNFAVRIXEGDFIP-JPKZNVRTSA-N. The full InChI is InChI=1S/C21H28NOSSi.C5H5.Fe/c1-21(2,3)18-14-23-20(22-18)19-16(12-13-17(19)25(4,5)6)24-15-10-8-7-9-11-15;1-2-4-5-3-1;/h7-13,18H,14H2,1-6H3;1-5H;/q;;+2/t18-;;/m1../s1.
What are the key properties of CID 10696443?
CID 10696443 has a molecular weight of 491.55 g/mol, XLogP of 6.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10696443 is sourced from PubChem (CID 10696443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).