C23H24N4O7S — CID 10696713
N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)piperazine-2-carboxamide (PubChem CID 10696713) has the molecular formula C23H24N4O7S and a molecular weight of 500.53 g/mol. Its IUPAC name is N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)piperazine-2-carboxamide.
| Compound Name | N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 10696713 |
| Molecular Formula | C23H24N4O7S |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)piperazine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)c3c(-c4ccccc4)noc3C)CC2C(=O)NO)cc1 |
| InChI | InChI=1S/C23H24N4O7S/c1-15-20(21(25-34-15)16-6-4-3-5-7-16)23(29)26-12-13-27(19(14-26)22(28)24-30)35(31,32)18-10-8-17(33-2)9-11-18/h3-11,19,30H,12-14H2,1-2H3,(H,24,28) |
| InChIKey | WQCOVODIHQDZNG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|