C8H14N4O2 — CID 106967902
1-[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]piperidin-4-ol (PubChem CID 106967902) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 1-[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]piperidin-4-ol.
| Compound Name | 1-[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 106967902 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]piperidin-4-ol |
| SMILES | NCc1nnc(N2CCC(O)CC2)o1 |
| InChI | InChI=1S/C8H14N4O2/c9-5-7-10-11-8(14-7)12-3-1-6(13)2-4-12/h6,13H,1-5,9H2 |
| InChIKey | ZNAUBQTWBBJDFZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |