C20H29BrO6SSi — CID 10696896
[(1S,4R,5S,6S)-4-(benzenesulfonyl)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl] methyl carbonate (PubChem CID 10696896) has the molecular formula C20H29BrO6SSi and a molecular weight of 505.50 g/mol. Its IUPAC name is [(1S,4R,5S,6S)-4-(benzenesulfonyl)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl] methyl carbonate.
| Compound Name | [(1S,4R,5S,6S)-4-(benzenesulfonyl)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl] methyl carbonate |
|---|---|
| PubChem CID | 10696896 |
| Molecular Formula | C20H29BrO6SSi |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | [(1S,4R,5S,6S)-4-(benzenesulfonyl)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl] methyl carbonate |
| SMILES | COC(=O)O[C@H]1C=C[C@@H](S(=O)(=O)c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1Br |
| InChI | InChI=1S/C20H29BrO6SSi/c1-20(2,3)29(5,6)27-18-16(28(23,24)14-10-8-7-9-11-14)13-12-15(17(18)21)26-19(22)25-4/h7-13,15-18H,1-6H3/t15-,16+,17-,18-/m0/s1 |
| InChIKey | AQIXJUBXVWDCGH-MHORFTMASA-N |
| XLogP | 4.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|