C32H52O3Si — CID 10697109
[(Z,7S)-7-[(1R)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-7-methoxyhept-3-en-1,5-diynyl]-tri(propan-2-yl)silane (PubChem CID 10697109) has the molecular formula C32H52O3Si and a molecular weight of 512.85 g/mol. Its IUPAC name is [(Z,7S)-7-[(1R)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-7-methoxyhept-3-en-1,5-diynyl]-tri(propan-2-yl)silane.
| Compound Name | [(Z,7S)-7-[(1R)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-7-methoxyhept-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10697109 |
| Molecular Formula | C32H52O3Si |
| Molecular Weight | 512.85 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | [(Z,7S)-7-[(1R)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-7-methoxyhept-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
| SMILES | CO[C@H](C#C/C=C\C#C[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1CCC(C)=C(C2OCC(C)(C)CO2)C1(C)C |
| InChI | InChI=1S/C32H52O3Si/c1-23(2)36(24(3)4,25(5)6)20-16-14-13-15-17-28(33-12)27-19-18-26(7)29(32(27,10)11)30-34-21-31(8,9)22-35-30/h13-14,23-25,27-28,30H,18-19,21-22H2,1-12H3/b14-13-/t27-,28+/m0/s1 |
| InChIKey | IHNZIPNVLDQGGX-VIOIWAGUSA-N |
| XLogP | 7.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.85 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|