C26H35N3O6Si — CID 10697128
methyl (4S,5R)-5-[(1S,2R)-2-azido-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxypropyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 10697128) has the molecular formula C26H35N3O6Si and a molecular weight of 513.67 g/mol. Its IUPAC name is methyl (4S,5R)-5-[(1S,2R)-2-azido-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxypropyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4S,5R)-5-[(1S,2R)-2-azido-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxypropyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 10697128 |
| Molecular Formula | C26H35N3O6Si |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | methyl (4S,5R)-5-[(1S,2R)-2-azido-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxypropyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)[C@H]1OC(C)(C)O[C@H]1[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C26H35N3O6Si/c1-25(2,3)36(18-13-9-7-10-14-18,19-15-11-8-12-16-19)35-21(20(17-30)28-29-27)22-23(24(31)32-6)34-26(4,5)33-22/h7-16,20-23,30H,17H2,1-6H3/t20-,21+,22+,23+/m1/s1 |
| InChIKey | GMRHEXJCXJPQSI-LDVJMBRRSA-N |
| XLogP | 3.30 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|