C14H16ClF3N2O — CID 106971642
7-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ol (PubChem CID 106971642) has the molecular formula C14H16ClF3N2O and a molecular weight of 320.74 g/mol. Its IUPAC name is 7-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ol.
| Compound Name | 7-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ol |
|---|---|
| PubChem CID | 106971642 |
| Molecular Formula | C14H16ClF3N2O |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 7-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ol |
| SMILES | OC1(c2ccc(C(F)(F)F)nc2Cl)CCN2CCCC2C1 |
| InChI | InChI=1S/C14H16ClF3N2O/c15-12-10(3-4-11(19-12)14(16,17)18)13(21)5-7-20-6-1-2-9(20)8-13/h3-4,9,21H,1-2,5-8H2 |
| InChIKey | RMDZWLTYWRZKDL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|