C11H11ClF3NOS — CID 106971988
[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(thiolan-3-yl)methanol (PubChem CID 106971988) has the molecular formula C11H11ClF3NOS and a molecular weight of 297.73 g/mol. Its IUPAC name is [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(thiolan-3-yl)methanol.
| Compound Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(thiolan-3-yl)methanol |
|---|---|
| PubChem CID | 106971988 |
| Molecular Formula | C11H11ClF3NOS |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(thiolan-3-yl)methanol |
| SMILES | OC(c1ccc(C(F)(F)F)nc1Cl)C1CCSC1 |
| InChI | InChI=1S/C11H11ClF3NOS/c12-10-7(9(17)6-3-4-18-5-6)1-2-8(16-10)11(13,14)15/h1-2,6,9,17H,3-5H2 |
| InChIKey | WERIBHFOTUNRRG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|