C12H19N3O2S — CID 106972325
2-ethyl-2-[[(6-methylsulfanylpyrimidin-4-yl)amino]methyl]butanoic acid (PubChem CID 106972325) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-ethyl-2-[[(6-methylsulfanylpyrimidin-4-yl)amino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[(6-methylsulfanylpyrimidin-4-yl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 106972325 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-ethyl-2-[[(6-methylsulfanylpyrimidin-4-yl)amino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNc1cc(SC)ncn1)C(=O)O |
| InChI | InChI=1S/C12H19N3O2S/c1-4-12(5-2,11(16)17)7-13-9-6-10(18-3)15-8-14-9/h6,8H,4-5,7H2,1-3H3,(H,16,17)(H,13,14,15) |
| InChIKey | UQBDRIDVFHNPGQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |