C29H31FN4O4 — CID 10697244
[3-(dimethylamino)phenyl] N-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate (PubChem CID 10697244) has the molecular formula C29H31FN4O4 and a molecular weight of 518.59 g/mol. Its IUPAC name is [3-(dimethylamino)phenyl] N-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate.
| Compound Name | [3-(dimethylamino)phenyl] N-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 10697244 |
| Molecular Formula | C29H31FN4O4 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | [3-(dimethylamino)phenyl] N-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate |
| SMILES | CC(C)CCN1C(=O)C(NC(=O)Oc2cccc(N(C)C)c2)C(=O)N(c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C29H31FN4O4/c1-19(2)16-17-33-24-14-7-8-15-25(24)34(23-13-6-5-12-22(23)30)28(36)26(27(33)35)31-29(37)38-21-11-9-10-20(18-21)32(3)4/h5-15,18-19,26H,16-17H2,1-4H3,(H,31,37) |
| InChIKey | SQCGUGLICJMFKI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|