C25H32F3N7O2 — CID 10697270
N,1,3-trimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 10697270) has the molecular formula C25H32F3N7O2 and a molecular weight of 519.57 g/mol. Its IUPAC name is N,1,3-trimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N,1,3-trimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10697270 |
| Molecular Formula | C25H32F3N7O2 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | N,1,3-trimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CNC(=O)c1cnc2c(c(C)nn2C)c1NCCCN1CCN(c2ccccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C25H32F3N7O2/c1-17-21-22(18(24(36)29-2)15-31-23(21)33(3)32-17)30-9-6-10-34-11-13-35(14-12-34)19-7-4-5-8-20(19)37-16-25(26,27)28/h4-5,7-8,15H,6,9-14,16H2,1-3H3,(H,29,36)(H,30,31) |
| InChIKey | BOCOQKWHWGXVMJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|