C13H19N3S — CID 106972899
N-(2,2-dicyclopropylethyl)-6-methylsulfanylpyrimidin-4-amine (PubChem CID 106972899) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is N-(2,2-dicyclopropylethyl)-6-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-(2,2-dicyclopropylethyl)-6-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106972899 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N-(2,2-dicyclopropylethyl)-6-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1cc(NCC(C2CC2)C2CC2)ncn1 |
| InChI | InChI=1S/C13H19N3S/c1-17-13-6-12(15-8-16-13)14-7-11(9-2-3-9)10-4-5-10/h6,8-11H,2-5,7H2,1H3,(H,14,15,16) |
| InChIKey | UEAYQCDXQWAROV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |