C13H20N4S — CID 106973276
4,4-dimethyl-5-(6-methylsulfanylpyrimidin-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 106973276) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is 4,4-dimethyl-5-(6-methylsulfanylpyrimidin-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-(6-methylsulfanylpyrimidin-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 106973276 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 4,4-dimethyl-5-(6-methylsulfanylpyrimidin-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CSc1cc(N2CC3CNCC3C2(C)C)ncn1 |
| InChI | InChI=1S/C13H20N4S/c1-13(2)10-6-14-5-9(10)7-17(13)11-4-12(18-3)16-8-15-11/h4,8-10,14H,5-7H2,1-3H3 |
| InChIKey | QRGGNKOVUVQWGH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |