C17H21N3O — CID 106973994
2-propyl-N-quinolin-8-ylpyrrolidine-2-carboxamide (PubChem CID 106973994) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-propyl-N-quinolin-8-ylpyrrolidine-2-carboxamide.
| Compound Name | 2-propyl-N-quinolin-8-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 106973994 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-propyl-N-quinolin-8-ylpyrrolidine-2-carboxamide |
| SMILES | CCCC1(C(=O)Nc2cccc3cccnc23)CCCN1 |
| InChI | InChI=1S/C17H21N3O/c1-2-9-17(10-5-12-19-17)16(21)20-14-8-3-6-13-7-4-11-18-15(13)14/h3-4,6-8,11,19H,2,5,9-10,12H2,1H3,(H,20,21) |
| InChIKey | FGYOBGNVZDGCCV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |