C13H26N2O — CID 106974201
N-ethyl-N,2-dipropylpyrrolidine-2-carboxamide (PubChem CID 106974201) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is N-ethyl-N,2-dipropylpyrrolidine-2-carboxamide.
| Compound Name | N-ethyl-N,2-dipropylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 106974201 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N-ethyl-N,2-dipropylpyrrolidine-2-carboxamide |
| SMILES | CCCN(CC)C(=O)C1(CCC)CCCN1 |
| InChI | InChI=1S/C13H26N2O/c1-4-8-13(9-7-10-14-13)12(16)15(6-3)11-5-2/h14H,4-11H2,1-3H3 |
| InChIKey | FWGRUDDERXQVAS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |