C31H45NO4S — CID 10697467
2-[6-cyclohexylsulfanyl-6-(3,4-dimethoxyphenyl)hexyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 10697467) has the molecular formula C31H45NO4S and a molecular weight of 527.77 g/mol. Its IUPAC name is 2-[6-cyclohexylsulfanyl-6-(3,4-dimethoxyphenyl)hexyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[6-cyclohexylsulfanyl-6-(3,4-dimethoxyphenyl)hexyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 10697467 |
| Molecular Formula | C31H45NO4S |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | 2-[6-cyclohexylsulfanyl-6-(3,4-dimethoxyphenyl)hexyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(C(CCCCCN2CCc3cc(OC)c(OC)cc3C2)SC2CCCCC2)cc1OC |
| InChI | InChI=1S/C31H45NO4S/c1-33-27-15-14-24(20-28(27)34-2)31(37-26-11-7-5-8-12-26)13-9-6-10-17-32-18-16-23-19-29(35-3)30(36-4)21-25(23)22-32/h14-15,19-21,26,31H,5-13,16-18,22H2,1-4H3 |
| InChIKey | QFOQKQPDVPKVEX-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|