C12H24N2O3 — CID 106974916
N-(2,2-dimethoxyethyl)-2-propylpyrrolidine-2-carboxamide (PubChem CID 106974916) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-propylpyrrolidine-2-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 106974916 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-propylpyrrolidine-2-carboxamide |
| SMILES | CCCC1(C(=O)NCC(OC)OC)CCCN1 |
| InChI | InChI=1S/C12H24N2O3/c1-4-6-12(7-5-8-14-12)11(15)13-9-10(16-2)17-3/h10,14H,4-9H2,1-3H3,(H,13,15) |
| InChIKey | KYDDYCRJZILQIR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|